Urolitin B (1139-83-9 factory Tovarna proizvajalca

Urolitin B

November 9, 2020

Urolitin BSpecifications

ime: Urolitin B
Kemijsko ime: 3-hidroksi-6H-dibenzo [b, d] piran-6-on
CAS: 1139-83-9
Kemijska formula: C13H8O3
Molekularna teža: X
Barva:  Bel prah
InChi ključ: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Koda SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funkcija: Urolitin B lahko izboljša delovanje mitohondrijev in mišic.

Urolitin B lahko med staranjem izboljša moč in vzdržljivost mišic.

uporaba: Urolitin B je črevesni mikrobni presnovek ellagitannisa in ima močne anti-oksidante in pro-oksidante, odvisno od sistema in pogojev testiranja. Urolitin B lahko kaže tudi estrogensko in / ali antiestrogeno aktivnost.
Topnost: Lahko topen v N, N-dimetilformamidu in dimetilmetilenu. Sulfon, malo topen v metanolu, etanolu in etil acetatu
Čas shranjevanja: Hygroscopic, -20 ° C zamrzovalnik, v inertni atmosferi
Pogoj pošiljanja: Temperatura okolja je nenevarna kemikalija. Ta izdelek je dovolj stabilen za nekaj tednov med običajnim prevozom in časom, ki ga porabijo v carini.